C26H17AsF20O2 — CID 102324684
1-tert-butyl-3,3,3',3'-tetrakis(1,1,2,2,2-pentafluoroethyl)-1,1'-spirobi[2,1λ5-benzoxarsole] (PubChem CID 102324684) has the molecular formula C26H17AsF20O2 and a molecular weight of 816.30 g/mol. Its IUPAC name is 1-tert-butyl-3,3,3',3'-tetrakis(1,1,2,2,2-pentafluoroethyl)-1,1'-spirobi[2,1λ5-benzoxarsole].
| Compound Name | 1-tert-butyl-3,3,3',3'-tetrakis(1,1,2,2,2-pentafluoroethyl)-1,1'-spirobi[2,1λ5-benzoxarsole] |
|---|---|
| PubChem CID | 102324684 |
| Molecular Formula | C26H17AsF20O2 |
| Molecular Weight | 816.30 g/mol |
| Exact Mass | 816.01 |
| IUPAC Name | 1-tert-butyl-3,3,3',3'-tetrakis(1,1,2,2,2-pentafluoroethyl)-1,1'-spirobi[2,1λ5-benzoxarsole] |
| SMILES | CC(C)(C)[As]12(OC(C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)F)c3ccccc31)OC(C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)F)c1ccccc12 |
| InChI | InChI=1S/C26H17AsF20O2/c1-16(2,3)27(14-10-6-4-8-12(14)17(48-27,19(28,29)23(36,37)38)20(30,31)24(39,40)41)15-11-7-5-9-13(15)18(49-27,21(32,33)25(42,43)44)22(34,35)26(45,46)47/h4-11H,1-3H3 |
| InChIKey | UTYDJGGKEPLISE-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.30 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|