C11H11BrF2 — CID 84729594
1-bromo-2-[1-(1,1-difluoroethyl)cyclopropyl]benzene (PubChem CID 84729594) has the molecular formula C11H11BrF2 and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-bromo-2-[1-(1,1-difluoroethyl)cyclopropyl]benzene.
| Compound Name | 1-bromo-2-[1-(1,1-difluoroethyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 84729594 |
| Molecular Formula | C11H11BrF2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-bromo-2-[1-(1,1-difluoroethyl)cyclopropyl]benzene |
| SMILES | CC(F)(F)C1(c2ccccc2Br)CC1 |
| InChI | InChI=1S/C11H11BrF2/c1-10(13,14)11(6-7-11)8-4-2-3-5-9(8)12/h2-5H,6-7H2,1H3 |
| InChIKey | UCDDOHLASJRQAC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |