C12H12F2O — CID 84723107
2-[1-(1,1-difluoroethyl)cyclopropyl]benzaldehyde (PubChem CID 84723107) has the molecular formula C12H12F2O and a molecular weight of 210.22 g/mol. Its IUPAC name is 2-[1-(1,1-difluoroethyl)cyclopropyl]benzaldehyde.
| Compound Name | 2-[1-(1,1-difluoroethyl)cyclopropyl]benzaldehyde |
|---|---|
| PubChem CID | 84723107 |
| Molecular Formula | C12H12F2O |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-[1-(1,1-difluoroethyl)cyclopropyl]benzaldehyde |
| SMILES | CC(F)(F)C1(c2ccccc2C=O)CC1 |
| InChI | InChI=1S/C12H12F2O/c1-11(13,14)12(6-7-12)10-5-3-2-4-9(10)8-15/h2-5,8H,6-7H2,1H3 |
| InChIKey | DJWZQFZGVWRJQY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|