C16H31NO — CID 79128825
1-[1-(aminomethyl)cyclobutyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol (PubChem CID 79128825) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclobutyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol.
| Compound Name | 1-[1-(aminomethyl)cyclobutyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79128825 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 1-[1-(aminomethyl)cyclobutyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
| SMILES | CCC(C)(C)C1CCC(O)(C2(CN)CCC2)CC1 |
| InChI | InChI=1S/C16H31NO/c1-4-14(2,3)13-6-10-16(18,11-7-13)15(12-17)8-5-9-15/h13,18H,4-12,17H2,1-3H3 |
| InChIKey | LKCGWHBPBKGIBW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |