C12H13NO — CID 79129299
2-(2-hydroxy-1,3-dihydroinden-2-yl)propanenitrile (PubChem CID 79129299) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(2-hydroxy-1,3-dihydroinden-2-yl)propanenitrile.
| Compound Name | 2-(2-hydroxy-1,3-dihydroinden-2-yl)propanenitrile |
|---|---|
| PubChem CID | 79129299 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-(2-hydroxy-1,3-dihydroinden-2-yl)propanenitrile |
| SMILES | CC(C#N)C1(O)Cc2ccccc2C1 |
| InChI | InChI=1S/C12H13NO/c1-9(8-13)12(14)6-10-4-2-3-5-11(10)7-12/h2-5,9,14H,6-7H2,1H3 |
| InChIKey | RYPLNUZUSVMJMK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |