C16H21ClFN3 — CID 79132548
N-[[1-(4-chloro-3-fluorophenyl)-5-propylpyrazol-4-yl]methyl]propan-1-amine (PubChem CID 79132548) has the molecular formula C16H21ClFN3 and a molecular weight of 309.82 g/mol. Its IUPAC name is N-[[1-(4-chloro-3-fluorophenyl)-5-propylpyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(4-chloro-3-fluorophenyl)-5-propylpyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 79132548 |
| Molecular Formula | C16H21ClFN3 |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[[1-(4-chloro-3-fluorophenyl)-5-propylpyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnn(-c2ccc(Cl)c(F)c2)c1CCC |
| InChI | InChI=1S/C16H21ClFN3/c1-3-5-16-12(10-19-8-4-2)11-20-21(16)13-6-7-14(17)15(18)9-13/h6-7,9,11,19H,3-5,8,10H2,1-2H3 |
| InChIKey | YAVAVSNGUWMEIU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|