C16H21ClFN3 — CID 79224678
N-[2-[1-(4-chloro-3-fluorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine (PubChem CID 79224678) has the molecular formula C16H21ClFN3 and a molecular weight of 309.82 g/mol. Its IUPAC name is N-[2-[1-(4-chloro-3-fluorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-[1-(4-chloro-3-fluorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79224678 |
| Molecular Formula | C16H21ClFN3 |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[2-[1-(4-chloro-3-fluorophenyl)-3,5-dimethylpyrazol-4-yl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1c(C)nn(-c2ccc(Cl)c(F)c2)c1C |
| InChI | InChI=1S/C16H21ClFN3/c1-4-8-19-9-7-14-11(2)20-21(12(14)3)13-5-6-15(17)16(18)10-13/h5-6,10,19H,4,7-9H2,1-3H3 |
| InChIKey | WXVRSUWSSYRQQG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|