C15H19NO — CID 79133045
2-(1-hydroxypentyl)-1,3-dihydroindene-2-carbonitrile (PubChem CID 79133045) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-(1-hydroxypentyl)-1,3-dihydroindene-2-carbonitrile.
| Compound Name | 2-(1-hydroxypentyl)-1,3-dihydroindene-2-carbonitrile |
|---|---|
| PubChem CID | 79133045 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-(1-hydroxypentyl)-1,3-dihydroindene-2-carbonitrile |
| SMILES | CCCCC(O)C1(C#N)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H19NO/c1-2-3-8-14(17)15(11-16)9-12-6-4-5-7-13(12)10-15/h4-7,14,17H,2-3,8-10H2,1H3 |
| InChIKey | JGMBICBJUCGCHP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |