C16H29NO — CID 79132594
1-(1-hydroxyheptyl)-4,4-dimethylcyclohexane-1-carbonitrile (PubChem CID 79132594) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 1-(1-hydroxyheptyl)-4,4-dimethylcyclohexane-1-carbonitrile.
| Compound Name | 1-(1-hydroxyheptyl)-4,4-dimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79132594 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1-(1-hydroxyheptyl)-4,4-dimethylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCC(O)C1(C#N)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H29NO/c1-4-5-6-7-8-14(18)16(13-17)11-9-15(2,3)10-12-16/h14,18H,4-12H2,1-3H3 |
| InChIKey | JCHHQWYCNLFVAO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|