C10H12N2O3S — CID 79133966
methyl N-[2-(3-aminophenyl)sulfanylacetyl]carbamate (PubChem CID 79133966) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is methyl N-[2-(3-aminophenyl)sulfanylacetyl]carbamate.
| Compound Name | methyl N-[2-(3-aminophenyl)sulfanylacetyl]carbamate |
|---|---|
| PubChem CID | 79133966 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl N-[2-(3-aminophenyl)sulfanylacetyl]carbamate |
| SMILES | COC(=O)NC(=O)CSc1cccc(N)c1 |
| InChI | InChI=1S/C10H12N2O3S/c1-15-10(14)12-9(13)6-16-8-4-2-3-7(11)5-8/h2-5H,6,11H2,1H3,(H,12,13,14) |
| InChIKey | KRUMUIAPLQFSRX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|