C14H17N3O2S — CID 79134132
2-(3-aminophenyl)sulfanyl-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide (PubChem CID 79134132) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 79134132 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
| SMILES | CC(C)c1cc(NC(=O)CSc2cccc(N)c2)on1 |
| InChI | InChI=1S/C14H17N3O2S/c1-9(2)12-7-14(19-17-12)16-13(18)8-20-11-5-3-4-10(15)6-11/h3-7,9H,8,15H2,1-2H3,(H,16,18) |
| InChIKey | KIPWHSRVSNJQDG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|