C11H17NO2S — CID 79134716
[4-(aminomethyl)oxan-4-yl]-thiophen-2-ylmethanol (PubChem CID 79134716) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is [4-(aminomethyl)oxan-4-yl]-thiophen-2-ylmethanol.
| Compound Name | [4-(aminomethyl)oxan-4-yl]-thiophen-2-ylmethanol |
|---|---|
| PubChem CID | 79134716 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | [4-(aminomethyl)oxan-4-yl]-thiophen-2-ylmethanol |
| SMILES | NCC1(C(O)c2cccs2)CCOCC1 |
| InChI | InChI=1S/C11H17NO2S/c12-8-11(3-5-14-6-4-11)10(13)9-2-1-7-15-9/h1-2,7,10,13H,3-6,8,12H2 |
| InChIKey | WTJZGWOOVDQDIA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |