About (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol
(R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol (PubChem CID 99962438) has the molecular formula C10H15NOS
and a molecular weight of 197.30 g/mol. Its IUPAC name is (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol.
Molecular Properties
| Compound Name | (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol |
| PubChem CID | 99962438 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol |
| SMILES | C[C@H]1C[C@]1(CN)[C@@H](O)c1cccs1 |
| InChI | InChI=1S/C10H15NOS/c1-7-5-10(7,6-11)9(12)8-3-2-4-13-8/h2-4,7,9,12H,5-6,11H2,1H3/t7-,9-,10+/m0/s1 |
| InChIKey | YEPZMFNTPLXJLU-UJNFCWOMSA-N |
| XLogP | 1.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol?
The IUPAC name of (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol (CID 99962438) is (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol.
What is the SMILES notation for (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol?
The canonical SMILES for (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol is C[C@H]1C[C@]1(CN)[C@@H](O)c1cccs1.
What is the InChIKey of (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol?
The InChIKey is YEPZMFNTPLXJLU-UJNFCWOMSA-N. The full InChI is InChI=1S/C10H15NOS/c1-7-5-10(7,6-11)9(12)8-3-2-4-13-8/h2-4,7,9,12H,5-6,11H2,1H3/t7-,9-,10+/m0/s1.
What are the key properties of (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol?
(R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol has a molecular weight of 197.30 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-[(1S,2S)-1-(aminomethyl)-2-methylcyclopropyl]-thiophen-2-ylmethanol is sourced from PubChem (CID 99962438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).