About 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile
3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile (PubChem CID 79137072) has the molecular formula C11H11BrFNO
and a molecular weight of 272.12 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile |
| PubChem CID | 79137072 |
| Molecular Formula | C11H11BrFNO |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile |
| SMILES | CC(C)(C#N)C(O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrFNO/c1-11(2,6-14)10(15)7-3-4-9(13)8(12)5-7/h3-5,10,15H,1-2H3 |
| InChIKey | PUJCVNAXWUMIJL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile?
The IUPAC name of 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile (CID 79137072) is 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile is CC(C)(C#N)C(O)c1ccc(F)c(Br)c1.
What is the InChIKey of 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile?
The InChIKey is PUJCVNAXWUMIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFNO/c1-11(2,6-14)10(15)7-3-4-9(13)8(12)5-7/h3-5,10,15H,1-2H3.
What are the key properties of 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile?
3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile has a molecular weight of 272.12 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-4-fluorophenyl)-3-hydroxy-2,2-dimethylpropanenitrile is sourced from PubChem (CID 79137072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).