C14H20BrFO — CID 79747122
1-(3-bromo-4-fluorophenyl)-3,4,4-trimethylpentan-1-ol (PubChem CID 79747122) has the molecular formula C14H20BrFO and a molecular weight of 303.22 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-3,4,4-trimethylpentan-1-ol.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-3,4,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 79747122 |
| Molecular Formula | C14H20BrFO |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-3,4,4-trimethylpentan-1-ol |
| SMILES | CC(CC(O)c1ccc(F)c(Br)c1)C(C)(C)C |
| InChI | InChI=1S/C14H20BrFO/c1-9(14(2,3)4)7-13(17)10-5-6-12(16)11(15)8-10/h5-6,8-9,13,17H,7H2,1-4H3 |
| InChIKey | MMIIPGNNKBURJL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |