About [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine
[5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine (PubChem CID 79139626) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine |
| PubChem CID | 79139626 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine |
| SMILES | Cc1ncsc1-c1ocnc1CN |
| InChI | InChI=1S/C8H9N3OS/c1-5-8(13-4-11-5)7-6(2-9)10-3-12-7/h3-4H,2,9H2,1H3 |
| InChIKey | QYFCYSLVCMITAN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine?
The IUPAC name of [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine (CID 79139626) is [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine.
What is the SMILES notation for [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine?
The canonical SMILES for [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine is Cc1ncsc1-c1ocnc1CN.
What is the InChIKey of [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine?
The InChIKey is QYFCYSLVCMITAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-5-8(13-4-11-5)7-6(2-9)10-3-12-7/h3-4H,2,9H2,1H3.
What are the key properties of [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine?
[5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine has a molecular weight of 195.25 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methyl-1,3-thiazol-5-yl)-1,3-oxazol-4-yl]methanamine is sourced from PubChem (CID 79139626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).