About 2-propan-2-yloxypropane
2-propan-2-yloxypropane (PubChem CID 7914) has the molecular formula C6H14O
and a molecular weight of 102.18 g/mol. Its IUPAC name is 2-propan-2-yloxypropane.
Molecular Properties
| Compound Name | 2-propan-2-yloxypropane |
| PubChem CID | 7914 |
| Molecular Formula | C6H14O |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.10 |
| IUPAC Name | 2-propan-2-yloxypropane |
| SMILES | CC(C)OC(C)C |
| InChI | InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3 |
| InChIKey | ZAFNJMIOTHYJRJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propan-2-yloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxypropane?
The IUPAC name of 2-propan-2-yloxypropane (CID 7914) is 2-propan-2-yloxypropane.
What is the SMILES notation for 2-propan-2-yloxypropane?
The canonical SMILES for 2-propan-2-yloxypropane is CC(C)OC(C)C.
What is the InChIKey of 2-propan-2-yloxypropane?
The InChIKey is ZAFNJMIOTHYJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3.
What are the key properties of 2-propan-2-yloxypropane?
2-propan-2-yloxypropane has a molecular weight of 102.18 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxypropane is sourced from PubChem (CID 7914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).