C16H13N3S — CID 79142596
4-[[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]benzonitrile (PubChem CID 79142596) has the molecular formula C16H13N3S and a molecular weight of 279.37 g/mol. Its IUPAC name is 4-[[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 79142596 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]benzonitrile |
| SMILES | Cc1ccc2nc(NCc3ccc(C#N)cc3)sc2c1 |
| InChI | InChI=1S/C16H13N3S/c1-11-2-7-14-15(8-11)20-16(19-14)18-10-13-5-3-12(9-17)4-6-13/h2-8H,10H2,1H3,(H,18,19) |
| InChIKey | CBKSTPQBECRARS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |