C14H18BrN3S — CID 79144163
3-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylaniline (PubChem CID 79144163) has the molecular formula C14H18BrN3S and a molecular weight of 340.29 g/mol. Its IUPAC name is 3-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylaniline.
| Compound Name | 3-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylaniline |
|---|---|
| PubChem CID | 79144163 |
| Molecular Formula | C14H18BrN3S |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylaniline |
| SMILES | CCc1nn(C)c(CSc2cccc(N)c2C)c1Br |
| InChI | InChI=1S/C14H18BrN3S/c1-4-11-14(15)12(18(3)17-11)8-19-13-7-5-6-10(16)9(13)2/h5-7H,4,8,16H2,1-3H3 |
| InChIKey | PFCOCQISFGFRDB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|