C12H14N2S2 — CID 79148477
2-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]aniline (PubChem CID 79148477) has the molecular formula C12H14N2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 2-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79148477 |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
| SMILES | Cc1nc(CSc2ccc(N)c(C)c2)cs1 |
| InChI | InChI=1S/C12H14N2S2/c1-8-5-11(3-4-12(8)13)16-7-10-6-15-9(2)14-10/h3-6H,7,13H2,1-2H3 |
| InChIKey | RNNXHFIAWCGIMZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|