C12H12FN3OS2 — CID 79140742
N-[4-[(4-amino-3-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 79140742) has the molecular formula C12H12FN3OS2 and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[4-[(4-amino-3-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[(4-amino-3-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 79140742 |
| Molecular Formula | C12H12FN3OS2 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[4-[(4-amino-3-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CSc2ccc(N)c(F)c2)cs1 |
| InChI | InChI=1S/C12H12FN3OS2/c1-7(17)15-12-16-8(6-19-12)5-18-9-2-3-11(14)10(13)4-9/h2-4,6H,5,14H2,1H3,(H,15,16,17) |
| InChIKey | IMBLFGQJTDAZOP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|