C15H12FN3S2 — CID 79129470
2-fluoro-4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline (PubChem CID 79129470) has the molecular formula C15H12FN3S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-fluoro-4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 2-fluoro-4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79129470 |
| Molecular Formula | C15H12FN3S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-fluoro-4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(SCc2csc(-c3ccccn3)n2)cc1F |
| InChI | InChI=1S/C15H12FN3S2/c16-12-7-11(4-5-13(12)17)20-8-10-9-21-15(19-10)14-3-1-2-6-18-14/h1-7,9H,8,17H2 |
| InChIKey | TZNSMNGETGPYQR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|