C15H13N3S2 — CID 43299180
4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline (PubChem CID 43299180) has the molecular formula C15H13N3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 43299180 |
| Molecular Formula | C15H13N3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(SCc2csc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C15H13N3S2/c16-11-4-6-13(7-5-11)19-9-12-10-20-15(18-12)14-3-1-2-8-17-14/h1-8,10H,9,16H2 |
| InChIKey | QPINREBYXQEZBA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|