C12H11FN2O3S — CID 79148892
2-[2-(2-amino-5-fluorophenyl)sulfanylacetyl]-5-methyl-1,2-oxazol-3-one (PubChem CID 79148892) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[2-(2-amino-5-fluorophenyl)sulfanylacetyl]-5-methyl-1,2-oxazol-3-one.
| Compound Name | 2-[2-(2-amino-5-fluorophenyl)sulfanylacetyl]-5-methyl-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 79148892 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[2-(2-amino-5-fluorophenyl)sulfanylacetyl]-5-methyl-1,2-oxazol-3-one |
| SMILES | Cc1cc(=O)n(C(=O)CSc2cc(F)ccc2N)o1 |
| InChI | InChI=1S/C12H11FN2O3S/c1-7-4-11(16)15(18-7)12(17)6-19-10-5-8(13)2-3-9(10)14/h2-5H,6,14H2,1H3 |
| InChIKey | HTABXJPQKHQQCY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|