C14H22N2O3 — CID 79150917
ethyl 2-[[6-methyl-2-(propylaminomethyl)-3-pyridinyl]oxy]acetate (PubChem CID 79150917) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl 2-[[6-methyl-2-(propylaminomethyl)-3-pyridinyl]oxy]acetate.
| Compound Name | ethyl 2-[[6-methyl-2-(propylaminomethyl)-3-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 79150917 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | ethyl 2-[[6-methyl-2-(propylaminomethyl)-3-pyridinyl]oxy]acetate |
| SMILES | CCCNCc1nc(C)ccc1OCC(=O)OCC |
| InChI | InChI=1S/C14H22N2O3/c1-4-8-15-9-12-13(7-6-11(3)16-12)19-10-14(17)18-5-2/h6-7,15H,4-5,8-10H2,1-3H3 |
| InChIKey | RTKGAFOOMOVQFJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|