C13H20N2O3 — CID 79151521
ethyl 2-[[2-(ethylaminomethyl)-6-methyl-3-pyridinyl]oxy]acetate (PubChem CID 79151521) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is ethyl 2-[[2-(ethylaminomethyl)-6-methyl-3-pyridinyl]oxy]acetate.
| Compound Name | ethyl 2-[[2-(ethylaminomethyl)-6-methyl-3-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 79151521 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | ethyl 2-[[2-(ethylaminomethyl)-6-methyl-3-pyridinyl]oxy]acetate |
| SMILES | CCNCc1nc(C)ccc1OCC(=O)OCC |
| InChI | InChI=1S/C13H20N2O3/c1-4-14-8-11-12(7-6-10(3)15-11)18-9-13(16)17-5-2/h6-7,14H,4-5,8-9H2,1-3H3 |
| InChIKey | JBNOHHCJMNMPMB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |