About 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride
3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride (PubChem CID 110168512) has the molecular formula C15H25ClN2O3
and a molecular weight of 316.83 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride |
| PubChem CID | 110168512 |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride |
| SMILES | CCc1nc(C)ccc1OCC(=O)OCCCN(C)C.Cl |
| InChI | InChI=1S/C15H24N2O3.ClH/c1-5-13-14(8-7-12(2)16-13)20-11-15(18)19-10-6-9-17(3)4;/h7-8H,5-6,9-11H2,1-4H3;1H |
| InChIKey | NQVWGNLTFVFFLU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride?
The IUPAC name of 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride (CID 110168512) is 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride?
The canonical SMILES for 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride is CCc1nc(C)ccc1OCC(=O)OCCCN(C)C.Cl.
What is the InChIKey of 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride?
The InChIKey is NQVWGNLTFVFFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3.ClH/c1-5-13-14(8-7-12(2)16-13)20-11-15(18)19-10-6-9-17(3)4;/h7-8H,5-6,9-11H2,1-4H3;1H.
What are the key properties of 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride?
3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride has a molecular weight of 316.83 g/mol, XLogP of 2.25, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 2-[(2-ethyl-6-methyl-3-pyridinyl)oxy]acetate;hydrochloride is sourced from PubChem (CID 110168512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).