C9H19N3O3 — CID 79152510
N-(2-amino-3-hydroxybutyl)morpholine-4-carboxamide (PubChem CID 79152510) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)morpholine-4-carboxamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 79152510 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)morpholine-4-carboxamide |
| SMILES | CC(O)C(N)CNC(=O)N1CCOCC1 |
| InChI | InChI=1S/C9H19N3O3/c1-7(13)8(10)6-11-9(14)12-2-4-15-5-3-12/h7-8,13H,2-6,10H2,1H3,(H,11,14) |
| InChIKey | PYEFGKAJYUTRSA-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |