C14H25N3O2 — CID 79152774
1,4-diazaspiro[5.5]undecan-1-yl(morpholin-4-yl)methanone (PubChem CID 79152774) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1,4-diazaspiro[5.5]undecan-1-yl(morpholin-4-yl)methanone.
| Compound Name | 1,4-diazaspiro[5.5]undecan-1-yl(morpholin-4-yl)methanone |
|---|---|
| PubChem CID | 79152774 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1,4-diazaspiro[5.5]undecan-1-yl(morpholin-4-yl)methanone |
| SMILES | O=C(N1CCOCC1)N1CCNCC12CCCCC2 |
| InChI | InChI=1S/C14H25N3O2/c18-13(16-8-10-19-11-9-16)17-7-6-15-12-14(17)4-2-1-3-5-14/h15H,1-12H2 |
| InChIKey | QFAMNQVERQJCAN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |