C15H26N2O3S — CID 104520740
1,4-diazaspiro[5.5]undecan-1-yl-(1,1-dioxothian-2-yl)methanone (PubChem CID 104520740) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 1,4-diazaspiro[5.5]undecan-1-yl-(1,1-dioxothian-2-yl)methanone.
| Compound Name | 1,4-diazaspiro[5.5]undecan-1-yl-(1,1-dioxothian-2-yl)methanone |
|---|---|
| PubChem CID | 104520740 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1,4-diazaspiro[5.5]undecan-1-yl-(1,1-dioxothian-2-yl)methanone |
| SMILES | O=C(C1CCCCS1(=O)=O)N1CCNCC12CCCCC2 |
| InChI | InChI=1S/C15H26N2O3S/c18-14(13-6-2-5-11-21(13,19)20)17-10-9-16-12-15(17)7-3-1-4-8-15/h13,16H,1-12H2 |
| InChIKey | PKBVCBKFMSXLMR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |