C14H16ClNO2 — CID 79153679
5-(4-butoxyphenyl)-4-(chloromethyl)-1,3-oxazole (PubChem CID 79153679) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-4-(chloromethyl)-1,3-oxazole.
| Compound Name | 5-(4-butoxyphenyl)-4-(chloromethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 79153679 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-(4-butoxyphenyl)-4-(chloromethyl)-1,3-oxazole |
| SMILES | CCCCOc1ccc(-c2ocnc2CCl)cc1 |
| InChI | InChI=1S/C14H16ClNO2/c1-2-3-8-17-12-6-4-11(5-7-12)14-13(9-15)16-10-18-14/h4-7,10H,2-3,8-9H2,1H3 |
| InChIKey | SDOHWUKPTPVOBT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|