C18H15ClN2O5 — CID 7915485
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 7915485) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7915485 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | COCc1c(C(=O)OCC(=O)Nc2cccnc2Cl)oc2ccccc12 |
| InChI | InChI=1S/C18H15ClN2O5/c1-24-9-12-11-5-2-3-7-14(11)26-16(12)18(23)25-10-15(22)21-13-6-4-8-20-17(13)19/h2-8H,9-10H2,1H3,(H,21,22) |
| InChIKey | AQFKKXAUVFDCRX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|