C12H17NO4 — CID 79156638
3-(3-ethoxy-2-hydroxypropoxy)-6-methylpyridine-2-carbaldehyde (PubChem CID 79156638) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-(3-ethoxy-2-hydroxypropoxy)-6-methylpyridine-2-carbaldehyde.
| Compound Name | 3-(3-ethoxy-2-hydroxypropoxy)-6-methylpyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 79156638 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-(3-ethoxy-2-hydroxypropoxy)-6-methylpyridine-2-carbaldehyde |
| SMILES | CCOCC(O)COc1ccc(C)nc1C=O |
| InChI | InChI=1S/C12H17NO4/c1-3-16-7-10(15)8-17-12-5-4-9(2)13-11(12)6-14/h4-6,10,15H,3,7-8H2,1-2H3 |
| InChIKey | ILWHYYVIIOYMTM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|