C11H16F2N2O2 — CID 79158985
N-[[3-(difluoromethoxy)-6-methyl-2-pyridinyl]methyl]-2-methoxyethanamine (PubChem CID 79158985) has the molecular formula C11H16F2N2O2 and a molecular weight of 246.26 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-6-methyl-2-pyridinyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-(difluoromethoxy)-6-methyl-2-pyridinyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79158985 |
| Molecular Formula | C11H16F2N2O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[[3-(difluoromethoxy)-6-methyl-2-pyridinyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nc(C)ccc1OC(F)F |
| InChI | InChI=1S/C11H16F2N2O2/c1-8-3-4-10(17-11(12)13)9(15-8)7-14-5-6-16-2/h3-4,11,14H,5-7H2,1-2H3 |
| InChIKey | FYDOEQDXMKQVHU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|