About 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide
4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide (PubChem CID 79159759) has the molecular formula C10H19N3OS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide |
| PubChem CID | 79159759 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide |
| SMILES | CCN(C)C(=O)N1CCC(C(N)=S)CC1 |
| InChI | InChI=1S/C10H19N3OS/c1-3-12(2)10(14)13-6-4-8(5-7-13)9(11)15/h8H,3-7H2,1-2H3,(H2,11,15) |
| InChIKey | PVUYGAVPBMPEDY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide?
The IUPAC name of 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide (CID 79159759) is 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide.
What is the SMILES notation for 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide?
The canonical SMILES for 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide is CCN(C)C(=O)N1CCC(C(N)=S)CC1.
What is the InChIKey of 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide?
The InChIKey is PVUYGAVPBMPEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3OS/c1-3-12(2)10(14)13-6-4-8(5-7-13)9(11)15/h8H,3-7H2,1-2H3,(H2,11,15).
What are the key properties of 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide?
4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide has a molecular weight of 229.35 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carbamothioyl-N-ethyl-N-methylpiperidine-1-carboxamide is sourced from PubChem (CID 79159759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).