C11H23N3O — CID 81456883
4-amino-N,3-diethyl-N-methylpiperidine-1-carboxamide (PubChem CID 81456883) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-amino-N,3-diethyl-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-amino-N,3-diethyl-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 81456883 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 4-amino-N,3-diethyl-N-methylpiperidine-1-carboxamide |
| SMILES | CCC1CN(C(=O)N(C)CC)CCC1N |
| InChI | InChI=1S/C11H23N3O/c1-4-9-8-14(7-6-10(9)12)11(15)13(3)5-2/h9-10H,4-8,12H2,1-3H3 |
| InChIKey | BDMPLEPIIDDVMS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |