C8H16N2O2 — CID 90001260
4-amino-3-ethylpiperidine-1-carboxylic acid (PubChem CID 90001260) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-amino-3-ethylpiperidine-1-carboxylic acid.
| Compound Name | 4-amino-3-ethylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90001260 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 4-amino-3-ethylpiperidine-1-carboxylic acid |
| SMILES | CCC1CN(C(=O)O)CCC1N |
| InChI | InChI=1S/C8H16N2O2/c1-2-6-5-10(8(11)12)4-3-7(6)9/h6-7H,2-5,9H2,1H3,(H,11,12) |
| InChIKey | XJGMHKQQWYUXMU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |