C10H20N2O2 — CID 166745692
(3R,4R)-4-(1-aminoethyl)-3-ethylpiperidine-1-carboxylic acid (PubChem CID 166745692) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3R,4R)-4-(1-aminoethyl)-3-ethylpiperidine-1-carboxylic acid.
| Compound Name | (3R,4R)-4-(1-aminoethyl)-3-ethylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 166745692 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (3R,4R)-4-(1-aminoethyl)-3-ethylpiperidine-1-carboxylic acid |
| SMILES | CC[C@H]1CN(C(=O)O)CC[C@H]1C(C)N |
| InChI | InChI=1S/C10H20N2O2/c1-3-8-6-12(10(13)14)5-4-9(8)7(2)11/h7-9H,3-6,11H2,1-2H3,(H,13,14)/t7?,8-,9-/m0/s1 |
| InChIKey | OPXDIDMKVZRDAJ-NPPUSCPJSA-N |
| XLogP | 1.36 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |