C10H18ClNO2 — CID 22803822
2-[(3R,4R)-1-chloro-3-ethylpiperidin-4-yl]propanoic acid (PubChem CID 22803822) has the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. Its IUPAC name is 2-[(3R,4R)-1-chloro-3-ethylpiperidin-4-yl]propanoic acid.
| Compound Name | 2-[(3R,4R)-1-chloro-3-ethylpiperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 22803822 |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-[(3R,4R)-1-chloro-3-ethylpiperidin-4-yl]propanoic acid |
| SMILES | CC[C@H]1CN(Cl)CC[C@H]1C(C)C(=O)O |
| InChI | InChI=1S/C10H18ClNO2/c1-3-8-6-12(11)5-4-9(8)7(2)10(13)14/h7-9H,3-6H2,1-2H3,(H,13,14)/t7?,8-,9-/m0/s1 |
| InChIKey | GJHCZARRKQNIHC-NPPUSCPJSA-N |
| XLogP | 2.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|