C13H19N3OS — CID 79161491
3-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-diethylurea (PubChem CID 79161491) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-diethylurea.
| Compound Name | 3-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 79161491 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCc1cc(C#CCN)cs1 |
| InChI | InChI=1S/C13H19N3OS/c1-3-16(4-2)13(17)15-9-12-8-11(10-18-12)6-5-7-14/h8,10H,3-4,7,9,14H2,1-2H3,(H,15,17) |
| InChIKey | NCUABRKCGMCVJZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|