C18H18ClN3O2S — CID 7916541
[(5R)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-ethoxy-3-pyridinyl)methanone (PubChem CID 7916541) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is [(5R)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-ethoxy-3-pyridinyl)methanone.
| Compound Name | [(5R)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-ethoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 7916541 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [(5R)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-ethoxy-3-pyridinyl)methanone |
| SMILES | CCOc1ncccc1C(=O)N1C[C@@H](C)S/C1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-3-24-16-15(5-4-10-20-16)17(23)22-11-12(2)25-18(22)21-14-8-6-13(19)7-9-14/h4-10,12H,3,11H2,1-2H3/b21-18-/t12-/m1/s1 |
| InChIKey | YTCXNCORANURQF-ACHDJDMMSA-N |
| XLogP | 4.40 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|