C17H25N3S — CID 79166415
3-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-phenylpropanethioamide (PubChem CID 79166415) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 3-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-phenylpropanethioamide.
| Compound Name | 3-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-phenylpropanethioamide |
|---|---|
| PubChem CID | 79166415 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-phenylpropanethioamide |
| SMILES | CN1C2CCC1CN(CC(C(N)=S)c1ccccc1)CC2 |
| InChI | InChI=1S/C17H25N3S/c1-19-14-7-8-15(19)11-20(10-9-14)12-16(17(18)21)13-5-3-2-4-6-13/h2-6,14-16H,7-12H2,1H3,(H2,18,21) |
| InChIKey | LJFTTWIMVQTRAS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|