C10H17Cl2N — CID 79167631
N-(2,3-dichloroprop-2-enyl)-3-methylcyclohexan-1-amine (PubChem CID 79167631) has the molecular formula C10H17Cl2N and a molecular weight of 222.16 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-3-methylcyclohexan-1-amine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79167631 |
| Molecular Formula | C10H17Cl2N |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-3-methylcyclohexan-1-amine |
| SMILES | CC1CCCC(NCC(Cl)=CCl)C1 |
| InChI | InChI=1S/C10H17Cl2N/c1-8-3-2-4-10(5-8)13-7-9(12)6-11/h6,8,10,13H,2-5,7H2,1H3 |
| InChIKey | WKADGDSKMVRRCO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |