C8H13Cl2N — CID 79167999
N-(2,3-dichloroprop-2-enyl)cyclopentanamine (PubChem CID 79167999) has the molecular formula C8H13Cl2N and a molecular weight of 194.10 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)cyclopentanamine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)cyclopentanamine |
|---|---|
| PubChem CID | 79167999 |
| Molecular Formula | C8H13Cl2N |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)cyclopentanamine |
| SMILES | ClC=C(Cl)CNC1CCCC1 |
| InChI | InChI=1S/C8H13Cl2N/c9-5-7(10)6-11-8-3-1-2-4-8/h5,8,11H,1-4,6H2 |
| InChIKey | YYDQQMYVSSXALR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |