C10H19Cl2N — CID 79167735
N-(2,3-dichloroprop-2-enyl)heptan-2-amine (PubChem CID 79167735) has the molecular formula C10H19Cl2N and a molecular weight of 224.17 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)heptan-2-amine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)heptan-2-amine |
|---|---|
| PubChem CID | 79167735 |
| Molecular Formula | C10H19Cl2N |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)heptan-2-amine |
| SMILES | CCCCCC(C)NCC(Cl)=CCl |
| InChI | InChI=1S/C10H19Cl2N/c1-3-4-5-6-9(2)13-8-10(12)7-11/h7,9,13H,3-6,8H2,1-2H3 |
| InChIKey | LQRWZMMMAWUXKH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|