C10H13Cl2NS — CID 79167926
2,3-dichloro-N-(1-thiophen-2-ylpropyl)prop-2-en-1-amine (PubChem CID 79167926) has the molecular formula C10H13Cl2NS and a molecular weight of 250.19 g/mol. Its IUPAC name is 2,3-dichloro-N-(1-thiophen-2-ylpropyl)prop-2-en-1-amine.
| Compound Name | 2,3-dichloro-N-(1-thiophen-2-ylpropyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 79167926 |
| Molecular Formula | C10H13Cl2NS |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2,3-dichloro-N-(1-thiophen-2-ylpropyl)prop-2-en-1-amine |
| SMILES | CCC(NCC(Cl)=CCl)c1cccs1 |
| InChI | InChI=1S/C10H13Cl2NS/c1-2-9(10-4-3-5-14-10)13-7-8(12)6-11/h3-6,9,13H,2,7H2,1H3 |
| InChIKey | NCWPLXIBDUZNFI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |