C13H17Cl2N — CID 79168001
4-tert-butyl-N-(2,3-dichloroprop-2-enyl)aniline (PubChem CID 79168001) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,3-dichloroprop-2-enyl)aniline.
| Compound Name | 4-tert-butyl-N-(2,3-dichloroprop-2-enyl)aniline |
|---|---|
| PubChem CID | 79168001 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-tert-butyl-N-(2,3-dichloroprop-2-enyl)aniline |
| SMILES | CC(C)(C)c1ccc(NCC(Cl)=CCl)cc1 |
| InChI | InChI=1S/C13H17Cl2N/c1-13(2,3)10-4-6-12(7-5-10)16-9-11(15)8-14/h4-8,16H,9H2,1-3H3 |
| InChIKey | NOQDDZDJXNLQKW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |