About 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid
3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid (PubChem CID 79170719) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid |
| PubChem CID | 79170719 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid |
| SMILES | CN1C2CCC1CN(c1nccc(C(=O)O)c1N)CC2 |
| InChI | InChI=1S/C14H20N4O2/c1-17-9-2-3-10(17)8-18(7-5-9)13-12(15)11(14(19)20)4-6-16-13/h4,6,9-10H,2-3,5,7-8,15H2,1H3,(H,19,20) |
| InChIKey | YOHJGDJFJVXDPH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid?
The IUPAC name of 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid (CID 79170719) is 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid.
What is the SMILES notation for 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid?
The canonical SMILES for 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid is CN1C2CCC1CN(c1nccc(C(=O)O)c1N)CC2.
What is the InChIKey of 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid?
The InChIKey is YOHJGDJFJVXDPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2/c1-17-9-2-3-10(17)8-18(7-5-9)13-12(15)11(14(19)20)4-6-16-13/h4,6,9-10H,2-3,5,7-8,15H2,1H3,(H,19,20).
What are the key properties of 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid?
3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid has a molecular weight of 276.34 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-4-carboxylic acid is sourced from PubChem (CID 79170719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).