C10H11Cl2NS — CID 79172755
2-(2,3-dichloroprop-2-enylsulfanyl)-6-methylaniline (PubChem CID 79172755) has the molecular formula C10H11Cl2NS and a molecular weight of 248.18 g/mol. Its IUPAC name is 2-(2,3-dichloroprop-2-enylsulfanyl)-6-methylaniline.
| Compound Name | 2-(2,3-dichloroprop-2-enylsulfanyl)-6-methylaniline |
|---|---|
| PubChem CID | 79172755 |
| Molecular Formula | C10H11Cl2NS |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 2-(2,3-dichloroprop-2-enylsulfanyl)-6-methylaniline |
| SMILES | Cc1cccc(SCC(Cl)=CCl)c1N |
| InChI | InChI=1S/C10H11Cl2NS/c1-7-3-2-4-9(10(7)13)14-6-8(12)5-11/h2-5H,6,13H2,1H3 |
| InChIKey | DUYJZFSQWKWTCV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|