C12H20Cl2N2 — CID 79172880
1-(2,3-dichloroprop-2-enyl)-4-pyrrolidin-2-ylpiperidine (PubChem CID 79172880) has the molecular formula C12H20Cl2N2 and a molecular weight of 263.21 g/mol. Its IUPAC name is 1-(2,3-dichloroprop-2-enyl)-4-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(2,3-dichloroprop-2-enyl)-4-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 79172880 |
| Molecular Formula | C12H20Cl2N2 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-(2,3-dichloroprop-2-enyl)-4-pyrrolidin-2-ylpiperidine |
| SMILES | ClC=C(Cl)CN1CCC(C2CCCN2)CC1 |
| InChI | InChI=1S/C12H20Cl2N2/c13-8-11(14)9-16-6-3-10(4-7-16)12-2-1-5-15-12/h8,10,12,15H,1-7,9H2 |
| InChIKey | ZKPWVPWZHHZVCB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |